C11H17N3O — CID 106895006
2,2-dimethyl-3-(pyridazin-3-ylmethylamino)cyclobutan-1-ol (PubChem CID 106895006) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2,2-dimethyl-3-(pyridazin-3-ylmethylamino)cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-(pyridazin-3-ylmethylamino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 106895006 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2,2-dimethyl-3-(pyridazin-3-ylmethylamino)cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NCc1cccnn1 |
| InChI | InChI=1S/C11H17N3O/c1-11(2)9(6-10(11)15)12-7-8-4-3-5-13-14-8/h3-5,9-10,12,15H,6-7H2,1-2H3 |
| InChIKey | FZYNRQIIPWJQDN-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |