C10H15NO2S2 — CID 66228306
3,3-dimethyl-5-thiophen-3-yl-1,4-thiazinane 1,1-dioxide (PubChem CID 66228306) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3,3-dimethyl-5-thiophen-3-yl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 3,3-dimethyl-5-thiophen-3-yl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 66228306 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3,3-dimethyl-5-thiophen-3-yl-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1(C)CS(=O)(=O)CC(c2ccsc2)N1 |
| InChI | InChI=1S/C10H15NO2S2/c1-10(2)7-15(12,13)6-9(11-10)8-3-4-14-5-8/h3-5,9,11H,6-7H2,1-2H3 |
| InChIKey | WXHQKXRPMACSSJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |