C14H21N3OS — CID 83243425
5-methyl-3-(1-methylpiperidin-4-yl)-2-thiophen-3-ylimidazolidin-4-one (PubChem CID 83243425) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 5-methyl-3-(1-methylpiperidin-4-yl)-2-thiophen-3-ylimidazolidin-4-one.
| Compound Name | 5-methyl-3-(1-methylpiperidin-4-yl)-2-thiophen-3-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 83243425 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-methyl-3-(1-methylpiperidin-4-yl)-2-thiophen-3-ylimidazolidin-4-one |
| SMILES | CC1NC(c2ccsc2)N(C2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C14H21N3OS/c1-10-14(18)17(12-3-6-16(2)7-4-12)13(15-10)11-5-8-19-9-11/h5,8-10,12-13,15H,3-4,6-7H2,1-2H3 |
| InChIKey | VBDKFJINNXEZFO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |