C13H17N3O2S — CID 47454041
1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]imidazolidin-2-one (PubChem CID 47454041) has the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]imidazolidin-2-one.
| Compound Name | 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 47454041 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-[2-[cyclopropyl(thiophen-3-ylmethyl)amino]acetyl]imidazolidin-2-one |
| SMILES | O=C(CN(Cc1ccsc1)C1CC1)N1CCNC1=O |
| InChI | InChI=1S/C13H17N3O2S/c17-12(16-5-4-14-13(16)18)8-15(11-1-2-11)7-10-3-6-19-9-10/h3,6,9,11H,1-2,4-5,7-8H2,(H,14,18) |
| InChIKey | KCALCTMADWSGIF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |