C11H22O2 — CID 130126601
2-(hydroxymethyl)-3,3,5,5-tetramethylcyclohexan-1-ol (PubChem CID 130126601) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,3,5,5-tetramethylcyclohexan-1-ol.
| Compound Name | 2-(hydroxymethyl)-3,3,5,5-tetramethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 130126601 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-(hydroxymethyl)-3,3,5,5-tetramethylcyclohexan-1-ol |
| SMILES | CC1(C)CC(O)C(CO)C(C)(C)C1 |
| InChI | InChI=1S/C11H22O2/c1-10(2)5-9(13)8(6-12)11(3,4)7-10/h8-9,12-13H,5-7H2,1-4H3 |
| InChIKey | FKTHUHHTKHXWTO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |