C9H17BrO2 — CID 101131576
(1R,2R,3R)-2-bromo-1,5,5-trimethylcyclohexane-1,3-diol (PubChem CID 101131576) has the molecular formula C9H17BrO2 and a molecular weight of 237.14 g/mol. Its IUPAC name is (1R,2R,3R)-2-bromo-1,5,5-trimethylcyclohexane-1,3-diol.
| Compound Name | (1R,2R,3R)-2-bromo-1,5,5-trimethylcyclohexane-1,3-diol |
|---|---|
| PubChem CID | 101131576 |
| Molecular Formula | C9H17BrO2 |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (1R,2R,3R)-2-bromo-1,5,5-trimethylcyclohexane-1,3-diol |
| SMILES | CC1(C)C[C@@H](O)[C@@H](Br)[C@](C)(O)C1 |
| InChI | InChI=1S/C9H17BrO2/c1-8(2)4-6(11)7(10)9(3,12)5-8/h6-7,11-12H,4-5H2,1-3H3/t6-,7-,9-/m1/s1 |
| InChIKey | RCRQEGSSZNZFNL-ZXFLCMHBSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|