C9H13Br3O — CID 100895585
(1S,3S,4S,6R)-4,7,7-tribromo-1,6-dimethylbicyclo[4.1.0]heptan-3-ol (PubChem CID 100895585) has the molecular formula C9H13Br3O and a molecular weight of 376.91 g/mol. Its IUPAC name is (1S,3S,4S,6R)-4,7,7-tribromo-1,6-dimethylbicyclo[4.1.0]heptan-3-ol.
| Compound Name | (1S,3S,4S,6R)-4,7,7-tribromo-1,6-dimethylbicyclo[4.1.0]heptan-3-ol |
|---|---|
| PubChem CID | 100895585 |
| Molecular Formula | C9H13Br3O |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 373.85 |
| IUPAC Name | (1S,3S,4S,6R)-4,7,7-tribromo-1,6-dimethylbicyclo[4.1.0]heptan-3-ol |
| SMILES | C[C@@]12C[C@H](Br)[C@@H](O)C[C@]1(C)C2(Br)Br |
| InChI | InChI=1S/C9H13Br3O/c1-7-3-5(10)6(13)4-8(7,2)9(7,11)12/h5-6,13H,3-4H2,1-2H3/t5-,6-,7+,8-/m0/s1 |
| InChIKey | UNNVKMAHOLSSIG-HSNKUXOKSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|