C8H16O2 — CID 10486972
(1R,3R,4R)-1,3,4-trimethylcyclopentane-1,3-diol (PubChem CID 10486972) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (1R,3R,4R)-1,3,4-trimethylcyclopentane-1,3-diol.
| Compound Name | (1R,3R,4R)-1,3,4-trimethylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 10486972 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (1R,3R,4R)-1,3,4-trimethylcyclopentane-1,3-diol |
| SMILES | C[C@@H]1C[C@@](C)(O)C[C@@]1(C)O |
| InChI | InChI=1S/C8H16O2/c1-6-4-7(2,9)5-8(6,3)10/h6,9-10H,4-5H2,1-3H3/t6-,7-,8-/m1/s1 |
| InChIKey | BPKTXTODDQFMKN-BWZBUEFSSA-N |
| XLogP | 0.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |