C12H24O — CID 131133876
cis-(1S,2S)-2-tert-butyl-5,5-dimethylcyclohexan-1-ol (PubChem CID 131133876) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is cis-(1S,2S)-2-tert-butyl-5,5-dimethylcyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-tert-butyl-5,5-dimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 131133876 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | cis-(1S,2S)-2-tert-butyl-5,5-dimethylcyclohexan-1-ol |
| SMILES | CC1(C)CC[C@@H](C(C)(C)C)[C@@H](O)C1 |
| InChI | InChI=1S/C12H24O/c1-11(2,3)9-6-7-12(4,5)8-10(9)13/h9-10,13H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | VEYCCFPADQUXEV-ZJUUUORDSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |