C9H16F2O — CID 167145522
(1R)-2-tert-butyl-4,4-difluorocyclopentan-1-ol (PubChem CID 167145522) has the molecular formula C9H16F2O and a molecular weight of 178.22 g/mol. Its IUPAC name is (1R)-2-tert-butyl-4,4-difluorocyclopentan-1-ol.
| Compound Name | (1R)-2-tert-butyl-4,4-difluorocyclopentan-1-ol |
|---|---|
| PubChem CID | 167145522 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | (1R)-2-tert-butyl-4,4-difluorocyclopentan-1-ol |
| SMILES | CC(C)(C)C1CC(F)(F)C[C@H]1O |
| InChI | InChI=1S/C9H16F2O/c1-8(2,3)6-4-9(10,11)5-7(6)12/h6-7,12H,4-5H2,1-3H3/t6?,7-/m1/s1 |
| InChIKey | VQDGXPURXDGAOP-COBSHVIPSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |