About 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane
7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane (PubChem CID 130396664) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane |
| PubChem CID | 130396664 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane |
| SMILES | CC(C)(C)C1CC2(CC1C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C15H28O2/c1-13(2,3)11-9-15(16-7-8-17-15)10-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | FYFWOFPQBSABLI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane?
The IUPAC name of 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane (CID 130396664) is 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane.
What is the SMILES notation for 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane?
The canonical SMILES for 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane is CC(C)(C)C1CC2(CC1C(C)(C)C)OCCO2.
What is the InChIKey of 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane?
The InChIKey is FYFWOFPQBSABLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-13(2,3)11-9-15(16-7-8-17-15)10-12(11)14(4,5)6/h11-12H,7-10H2,1-6H3.
What are the key properties of 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane?
7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane has a molecular weight of 240.39 g/mol, XLogP of 3.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-ditert-butyl-1,4-dioxaspiro[4.4]nonane is sourced from PubChem (CID 130396664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).