C12H22O2 — CID 93482217
(7R)-7-tert-butyl-1,4-dioxaspiro[4.5]decane (PubChem CID 93482217) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (7R)-7-tert-butyl-1,4-dioxaspiro[4.5]decane.
| Compound Name | (7R)-7-tert-butyl-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 93482217 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (7R)-7-tert-butyl-1,4-dioxaspiro[4.5]decane |
| SMILES | CC(C)(C)[C@@H]1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C12H22O2/c1-11(2,3)10-5-4-6-12(9-10)13-7-8-14-12/h10H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | NPSDJGXZMLTNLN-SNVBAGLBSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |