C13H18O2 — CID 11085008
(3aR,6aR)-4-propan-2-ylidenespiro[1,3,3a,6a-tetrahydropentalene-2,2'-1,3-dioxolane] (PubChem CID 11085008) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3aR,6aR)-4-propan-2-ylidenespiro[1,3,3a,6a-tetrahydropentalene-2,2'-1,3-dioxolane].
| Compound Name | (3aR,6aR)-4-propan-2-ylidenespiro[1,3,3a,6a-tetrahydropentalene-2,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 11085008 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3aR,6aR)-4-propan-2-ylidenespiro[1,3,3a,6a-tetrahydropentalene-2,2'-1,3-dioxolane] |
| SMILES | CC(C)=C1C=C[C@H]2CC3(C[C@@H]12)OCCO3 |
| InChI | InChI=1S/C13H18O2/c1-9(2)11-4-3-10-7-13(8-12(10)11)14-5-6-15-13/h3-4,10,12H,5-8H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | RPPVSFDXFNDGMO-CMPLNLGQSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |