C11H16O3 — CID 15054252
spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-ylmethanol (PubChem CID 15054252) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-ylmethanol.
| Compound Name | spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-ylmethanol |
|---|---|
| PubChem CID | 15054252 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-ylmethanol |
| SMILES | OCC1=CC2CC3(CC2C1)OCCO3 |
| InChI | InChI=1S/C11H16O3/c12-7-8-3-9-5-11(6-10(9)4-8)13-1-2-14-11/h3,9-10,12H,1-2,4-7H2 |
| InChIKey | GEYCUGCGWBBPRU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|