C21H22O4 — CID 12885727
(7S,9S)-7,9-diphenyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (PubChem CID 12885727) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (7S,9S)-7,9-diphenyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid.
| Compound Name | (7S,9S)-7,9-diphenyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 12885727 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (7S,9S)-7,9-diphenyl-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| SMILES | O=C(O)C1[C@@H](c2ccccc2)CC2(C[C@@H]1c1ccccc1)OCCO2 |
| InChI | InChI=1S/C21H22O4/c22-20(23)19-17(15-7-3-1-4-8-15)13-21(24-11-12-25-21)14-18(19)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2,(H,22,23)/t17-,18-/m1/s1 |
| InChIKey | PEENZSLWGGBVBC-QZTJIDSGSA-N |
| XLogP | 3.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |