C22H25NO4 — CID 71613650
ethyl (7R,9R)-7,9-diphenyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 71613650) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl (7R,9R)-7,9-diphenyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | ethyl (7R,9R)-7,9-diphenyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 71613650 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl (7R,9R)-7,9-diphenyl-1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CCOC(=O)N1[C@@H](c2ccccc2)CC2(C[C@@H]1c1ccccc1)OCCO2 |
| InChI | InChI=1S/C22H25NO4/c1-2-25-21(24)23-19(17-9-5-3-6-10-17)15-22(26-13-14-27-22)16-20(23)18-11-7-4-8-12-18/h3-12,19-20H,2,13-16H2,1H3/t19-,20-/m1/s1 |
| InChIKey | IYXDBILGVOHHPM-WOJBJXKFSA-N |
| XLogP | 4.46 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |