C22H25NO3 — CID 102317060
ethyl (2S,3R,5R,6R)-3,5-dimethyl-4-oxo-2,6-diphenylpiperidine-1-carboxylate (PubChem CID 102317060) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is ethyl (2S,3R,5R,6R)-3,5-dimethyl-4-oxo-2,6-diphenylpiperidine-1-carboxylate.
| Compound Name | ethyl (2S,3R,5R,6R)-3,5-dimethyl-4-oxo-2,6-diphenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102317060 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | ethyl (2S,3R,5R,6R)-3,5-dimethyl-4-oxo-2,6-diphenylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1[C@H](c2ccccc2)[C@@H](C)C(=O)[C@H](C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-4-26-22(25)23-19(17-11-7-5-8-12-17)15(2)21(24)16(3)20(23)18-13-9-6-10-14-18/h5-16,19-20H,4H2,1-3H3/t15-,16-,19-,20+/m1/s1 |
| InChIKey | XSNOQKDENUFKOQ-SMOSDQRPSA-N |
| XLogP | 4.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |