C31H27NO3 — CID 100925046
ethyl 2-[(2R,4R)-2,3,4-triphenylazetidine-1-carbonyl]benzoate (PubChem CID 100925046) has the molecular formula C31H27NO3 and a molecular weight of 461.56 g/mol. Its IUPAC name is ethyl 2-[(2R,4R)-2,3,4-triphenylazetidine-1-carbonyl]benzoate.
| Compound Name | ethyl 2-[(2R,4R)-2,3,4-triphenylazetidine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 100925046 |
| Molecular Formula | C31H27NO3 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | ethyl 2-[(2R,4R)-2,3,4-triphenylazetidine-1-carbonyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1C(=O)N1[C@@H](c2ccccc2)C(c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H27NO3/c1-2-35-31(34)26-21-13-12-20-25(26)30(33)32-28(23-16-8-4-9-17-23)27(22-14-6-3-7-15-22)29(32)24-18-10-5-11-19-24/h3-21,27-29H,2H2,1H3/t28-,29-/m0/s1 |
| InChIKey | WSVSBYRYLLKAGB-VMPREFPWSA-N |
| XLogP | 6.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |