C10H22Cl2O — CID 141116426
3,3,5,5-tetramethylcyclohexan-1-ol;dihydrochloride (PubChem CID 141116426) has the molecular formula C10H22Cl2O and a molecular weight of 229.19 g/mol. Its IUPAC name is 3,3,5,5-tetramethylcyclohexan-1-ol;dihydrochloride.
| Compound Name | 3,3,5,5-tetramethylcyclohexan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 141116426 |
| Molecular Formula | C10H22Cl2O |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3,3,5,5-tetramethylcyclohexan-1-ol;dihydrochloride |
| SMILES | CC1(C)CC(O)CC(C)(C)C1.Cl.Cl |
| InChI | InChI=1S/C10H20O.2ClH/c1-9(2)5-8(11)6-10(3,4)7-9;;/h8,11H,5-7H2,1-4H3;2*1H |
| InChIKey | NANWLIKUXCTQCC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |