C18H32O2 — CID 124865438
(1S,1'S,2R,4S,6S)-4,5',5',7,7-pentamethylspiro[bicyclo[2.2.2]octane-6,3'-cyclohexane]-1',2-diol (PubChem CID 124865438) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (1S,1'S,2R,4S,6S)-4,5',5',7,7-pentamethylspiro[bicyclo[2.2.2]octane-6,3'-cyclohexane]-1',2-diol.
| Compound Name | (1S,1'S,2R,4S,6S)-4,5',5',7,7-pentamethylspiro[bicyclo[2.2.2]octane-6,3'-cyclohexane]-1',2-diol |
|---|---|
| PubChem CID | 124865438 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (1S,1'S,2R,4S,6S)-4,5',5',7,7-pentamethylspiro[bicyclo[2.2.2]octane-6,3'-cyclohexane]-1',2-diol |
| SMILES | CC1(C)C[C@H](O)C[C@]2(C1)C[C@@]1(C)C[C@@H](O)[C@H]2C(C)(C)C1 |
| InChI | InChI=1S/C18H32O2/c1-15(2)6-12(19)7-18(9-15)11-17(5)8-13(20)14(18)16(3,4)10-17/h12-14,19-20H,6-11H2,1-5H3/t12-,13+,14-,17-,18-/m0/s1 |
| InChIKey | OYKKAFUDCTVRPS-UKCJKJFHSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |