C12H23N — CID 103961210
5,5,7,7-tetramethylspiro[2.5]octan-2-amine (PubChem CID 103961210) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 5,5,7,7-tetramethylspiro[2.5]octan-2-amine.
| Compound Name | 5,5,7,7-tetramethylspiro[2.5]octan-2-amine |
|---|---|
| PubChem CID | 103961210 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 5,5,7,7-tetramethylspiro[2.5]octan-2-amine |
| SMILES | CC1(C)CC(C)(C)CC2(CC2N)C1 |
| InChI | InChI=1S/C12H23N/c1-10(2)6-11(3,4)8-12(7-10)5-9(12)13/h9H,5-8,13H2,1-4H3 |
| InChIKey | JYDYOGNOYFUIPE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |