C8H17NO — CID 166894829
(3S)-1,5,5-trimethylpiperidin-3-ol (PubChem CID 166894829) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is (3S)-1,5,5-trimethylpiperidin-3-ol.
| Compound Name | (3S)-1,5,5-trimethylpiperidin-3-ol |
|---|---|
| PubChem CID | 166894829 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | (3S)-1,5,5-trimethylpiperidin-3-ol |
| SMILES | CN1C[C@@H](O)CC(C)(C)C1 |
| InChI | InChI=1S/C8H17NO/c1-8(2)4-7(10)5-9(3)6-8/h7,10H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | BGNZGNGNEXDJHS-ZETCQYMHSA-N |
| XLogP | 0.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |