C8H18FNO — CID 177317918
ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol (PubChem CID 177317918) has the molecular formula C8H18FNO and a molecular weight of 163.24 g/mol. Its IUPAC name is ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol.
| Compound Name | ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 177317918 |
| Molecular Formula | C8H18FNO |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol |
| SMILES | CC.CN1CC(O)C(C)(F)C1 |
| InChI | InChI=1S/C6H12FNO.C2H6/c1-6(7)4-8(2)3-5(6)9;1-2/h5,9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | JDPSWQSJUUSXMG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |