About ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol
ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol (PubChem CID 177317918) has the molecular formula C8H18FNO
and a molecular weight of 163.24 g/mol. Its IUPAC name is ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol |
| PubChem CID | 177317918 |
| Molecular Formula | C8H18FNO |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol |
| SMILES | CC.CN1CC(O)C(C)(F)C1 |
| InChI | InChI=1S/C6H12FNO.C2H6/c1-6(7)4-8(2)3-5(6)9;1-2/h5,9H,3-4H2,1-2H3;1-2H3 |
| InChIKey | JDPSWQSJUUSXMG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol?
The IUPAC name of ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol (CID 177317918) is ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol.
What is the SMILES notation for ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol?
The canonical SMILES for ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol is CC.CN1CC(O)C(C)(F)C1.
What is the InChIKey of ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol?
The InChIKey is JDPSWQSJUUSXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12FNO.C2H6/c1-6(7)4-8(2)3-5(6)9;1-2/h5,9H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol?
ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol has a molecular weight of 163.24 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-fluoro-1,4-dimethylpyrrolidin-3-ol is sourced from PubChem (CID 177317918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).