C10H22NO+ — CID 6992729
1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol (PubChem CID 6992729) has the molecular formula C10H22NO+ and a molecular weight of 172.29 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol.
| Compound Name | 1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 6992729 |
| Molecular Formula | C10H22NO+ |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.17 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidin-1-ium-4-ol |
| SMILES | C[NH+]1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C10H21NO/c1-9(2)6-8(12)7-10(3,4)11(9)5/h8,12H,6-7H2,1-5H3/p+1 |
| InChIKey | NWHNXXMYEICZAT-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |