C18H40N2O8S — CID 173256440
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol);sulfuric acid (PubChem CID 173256440) has the molecular formula C18H40N2O8S and a molecular weight of 444.59 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol);sulfuric acid.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol);sulfuric acid |
|---|---|
| PubChem CID | 173256440 |
| Molecular Formula | C18H40N2O8S |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ol);sulfuric acid |
| SMILES | CC1(C)CC(O)CC(C)(C)N1O.CC1(C)CC(O)CC(C)(C)N1O.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H19NO2.H2O4S/c2*1-8(2)5-7(11)6-9(3,4)10(8)12;1-5(2,3)4/h2*7,11-12H,5-6H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | LDXSSVPBASJFTJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 162.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|