C9H18NO5S- — CID 20626758
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) sulfate (PubChem CID 20626758) has the molecular formula C9H18NO5S- and a molecular weight of 252.31 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) sulfate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) sulfate |
|---|---|
| PubChem CID | 20626758 |
| Molecular Formula | C9H18NO5S- |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) sulfate |
| SMILES | CC1(C)CC(OS(=O)(=O)[O-])CC(C)(C)N1O |
| InChI | InChI=1S/C9H19NO5S/c1-8(2)5-7(15-16(12,13)14)6-9(3,4)10(8)11/h7,11H,5-6H2,1-4H3,(H,12,13,14)/p-1 |
| InChIKey | BDNRDSOWVPOMPY-UHFFFAOYSA-M |
| XLogP | 0.87 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|