C19H39N2O5P — CID 58825118
1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-methylphosphoryl]oxy-2,2,6,6-tetramethylpiperidine (PubChem CID 58825118) has the molecular formula C19H39N2O5P and a molecular weight of 406.50 g/mol. Its IUPAC name is 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-methylphosphoryl]oxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-methylphosphoryl]oxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 58825118 |
| Molecular Formula | C19H39N2O5P |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxy-methylphosphoryl]oxy-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(OP(C)(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C19H39N2O5P/c1-16(2)10-14(11-17(3,4)20(16)22)25-27(9,24)26-15-12-18(5,6)21(23)19(7,8)13-15/h14-15,22-23H,10-13H2,1-9H3 |
| InChIKey | QGYQFIWCWXSSGG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|