C20H42N2O2 — CID 162143693
1-hydroxy-2,2,4,6,6-pentamethylpiperidine (PubChem CID 162143693) has the molecular formula C20H42N2O2 and a molecular weight of 342.57 g/mol. Its IUPAC name is 1-hydroxy-2,2,4,6,6-pentamethylpiperidine.
| Compound Name | 1-hydroxy-2,2,4,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 162143693 |
| Molecular Formula | C20H42N2O2 |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.32 |
| IUPAC Name | 1-hydroxy-2,2,4,6,6-pentamethylpiperidine |
| SMILES | CC1CC(C)(C)N(O)C(C)(C)C1.CC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/2C10H21NO/c2*1-8-6-9(2,3)11(12)10(4,5)7-8/h2*8,12H,6-7H2,1-5H3 |
| InChIKey | WREGTQKRYQPMMY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |