C19H36N2O2-2 — CID 20749510
2,2,6,6-tetramethyl-1-oxido-4-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)methyl]piperidine (PubChem CID 20749510) has the molecular formula C19H36N2O2-2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-oxido-4-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)methyl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-oxido-4-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 20749510 |
| Molecular Formula | C19H36N2O2-2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-oxido-4-[(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)methyl]piperidine |
| SMILES | CC1(C)CC(CC2CC(C)(C)N([O-])C(C)(C)C2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C19H36N2O2/c1-16(2)10-14(11-17(3,4)20(16)22)9-15-12-18(5,6)21(23)19(7,8)13-15/h14-15H,9-13H2,1-8H3/q-2 |
| InChIKey | GZLSRSBNUOHAQC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |