C21H42N2O2 — CID 21348345
2,2,4,6,6-pentamethyl-1-[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxymethoxy]piperidine (PubChem CID 21348345) has the molecular formula C21H42N2O2 and a molecular weight of 354.58 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-1-[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxymethoxy]piperidine.
| Compound Name | 2,2,4,6,6-pentamethyl-1-[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxymethoxy]piperidine |
|---|---|
| PubChem CID | 21348345 |
| Molecular Formula | C21H42N2O2 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.32 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-1-[(2,2,4,6,6-pentamethylpiperidin-1-yl)oxymethoxy]piperidine |
| SMILES | CC1CC(C)(C)N(OCON2C(C)(C)CC(C)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C21H42N2O2/c1-16-11-18(3,4)22(19(5,6)12-16)24-15-25-23-20(7,8)13-17(2)14-21(23,9)10/h16-17H,11-15H2,1-10H3 |
| InChIKey | UALDFWGKTCIZJD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|