C24H52N2O3 — CID 161023393
1-ethoxy-2,2,4,6,6-pentamethylpiperidine;1-ethoxy-2,2,6,6-tetramethylpiperidin-4-ol;methane (PubChem CID 161023393) has the molecular formula C24H52N2O3 and a molecular weight of 416.69 g/mol. Its IUPAC name is 1-ethoxy-2,2,4,6,6-pentamethylpiperidine;1-ethoxy-2,2,6,6-tetramethylpiperidin-4-ol;methane.
| Compound Name | 1-ethoxy-2,2,4,6,6-pentamethylpiperidine;1-ethoxy-2,2,6,6-tetramethylpiperidin-4-ol;methane |
|---|---|
| PubChem CID | 161023393 |
| Molecular Formula | C24H52N2O3 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.40 |
| IUPAC Name | 1-ethoxy-2,2,4,6,6-pentamethylpiperidine;1-ethoxy-2,2,6,6-tetramethylpiperidin-4-ol;methane |
| SMILES | C.CCON1C(C)(C)CC(C)CC1(C)C.CCON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C12H25NO.C11H23NO2.CH4/c1-7-14-13-11(3,4)8-10(2)9-12(13,5)6;1-6-14-12-10(2,3)7-9(13)8-11(12,4)5;/h10H,7-9H2,1-6H3;9,13H,6-8H2,1-5H3;1H4 |
| InChIKey | TYRAMXFVDALHOO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |