C9H18NO3 — CID 102188245
CID 102188245 (PubChem CID 102188245) has the molecular formula C9H18NO3 and a molecular weight of 188.25 g/mol.
| Compound Name | CID 102188245 |
|---|---|
| PubChem CID | 102188245 |
| Molecular Formula | C9H18NO3 |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(O)CC(C)(C)N1O[O] |
| InChI | InChI=1S/C9H18NO3/c1-8(2)5-7(11)6-9(3,4)10(8)13-12/h7,11H,5-6H2,1-4H3 |
| InChIKey | HZNPVFVRWDYRSX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|