C9H19NO5P+ — CID 172793383
hydroxy-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-oxophosphanium (PubChem CID 172793383) has the molecular formula C9H19NO5P+ and a molecular weight of 252.23 g/mol. Its IUPAC name is hydroxy-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-oxophosphanium.
| Compound Name | hydroxy-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-oxophosphanium |
|---|---|
| PubChem CID | 172793383 |
| Molecular Formula | C9H19NO5P+ |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | hydroxy-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)peroxy-oxophosphanium |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OO[P+](=O)O |
| InChI | InChI=1S/C9H18NO5P/c1-8(2)5-7(11)6-9(3,4)10(8)14-15-16(12)13/h7,11H,5-6H2,1-4H3/p+1 |
| InChIKey | BQAKZBLXWPBSCQ-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|