C13H27NO2 — CID 88999908
1-butan-2-yloxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 88999908) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 1-butan-2-yloxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-butan-2-yloxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 88999908 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 1-butan-2-yloxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CCC(C)ON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C13H27NO2/c1-7-10(2)16-14-12(3,4)8-11(15)9-13(14,5)6/h10-11,15H,7-9H2,1-6H3 |
| InChIKey | ADKHFCDWAXVDPT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |