C12H23NO2 — CID 22094181
2,2,6,6-tetramethyl-1-prop-2-enoxypiperidin-4-ol (PubChem CID 22094181) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-prop-2-enoxypiperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-prop-2-enoxypiperidin-4-ol |
|---|---|
| PubChem CID | 22094181 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-prop-2-enoxypiperidin-4-ol |
| SMILES | C=CCON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C12H23NO2/c1-6-7-15-13-11(2,3)8-10(14)9-12(13,4)5/h6,10,14H,1,7-9H2,2-5H3 |
| InChIKey | YUJWYSNPVXYEII-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|