C22H44N2O5 — CID 22507657
1-[3-hydroxy-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutoxy]-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 22507657) has the molecular formula C22H44N2O5 and a molecular weight of 416.60 g/mol. Its IUPAC name is 1-[3-hydroxy-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutoxy]-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-[3-hydroxy-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 22507657 |
| Molecular Formula | C22H44N2O5 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | 1-[3-hydroxy-4-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxybutoxy]-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OCCC(O)CON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C22H44N2O5/c1-19(2)11-17(26)12-20(3,4)23(19)28-10-9-16(25)15-29-24-21(5,6)13-18(27)14-22(24,7)8/h16-18,25-27H,9-15H2,1-8H3 |
| InChIKey | ATBQGWBOEIWDMF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |