C15H29NO2 — CID 25229263
2,2,6,6-tetramethyl-1-(2-methylpent-4-en-2-yloxy)piperidin-4-ol (PubChem CID 25229263) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(2-methylpent-4-en-2-yloxy)piperidin-4-ol.
| Compound Name | 2,2,6,6-tetramethyl-1-(2-methylpent-4-en-2-yloxy)piperidin-4-ol |
|---|---|
| PubChem CID | 25229263 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(2-methylpent-4-en-2-yloxy)piperidin-4-ol |
| SMILES | C=CCC(C)(C)ON1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C15H29NO2/c1-8-9-15(6,7)18-16-13(2,3)10-12(17)11-14(16,4)5/h8,12,17H,1,9-11H2,2-7H3 |
| InChIKey | BWNZXAJQHBEGCC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|