C26H48N2O6 — CID 141285453
bis(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate (PubChem CID 141285453) has the molecular formula C26H48N2O6 and a molecular weight of 484.68 g/mol. Its IUPAC name is bis(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate.
| Compound Name | bis(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate |
|---|---|
| PubChem CID | 141285453 |
| Molecular Formula | C26H48N2O6 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.35 |
| IUPAC Name | bis(1-ethoxy-2,2,6,6-tetramethylpiperidin-4-yl) butanedioate |
| SMILES | CCON1C(C)(C)CC(OC(=O)CCC(=O)OC2CC(C)(C)N(OCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C26H48N2O6/c1-11-31-27-23(3,4)15-19(16-24(27,5)6)33-21(29)13-14-22(30)34-20-17-25(7,8)28(32-12-2)26(9,10)18-20/h19-20H,11-18H2,1-10H3 |
| InChIKey | OYWWBLTUISMRIX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |