C38H70N2O12 — CID 22743585
4-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl butanedioate;6-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl hexanedioate (PubChem CID 22743585) has the molecular formula C38H70N2O12 and a molecular weight of 746.98 g/mol. Its IUPAC name is 4-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl butanedioate;6-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl hexanedioate.
| Compound Name | 4-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl butanedioate;6-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl hexanedioate |
|---|---|
| PubChem CID | 22743585 |
| Molecular Formula | C38H70N2O12 |
| Molecular Weight | 746.98 g/mol |
| Exact Mass | 746.49 |
| IUPAC Name | 4-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl butanedioate;6-O-[1-(2-hydroxy-2-methylpropoxy)-2,2,6,6-tetramethylpiperidin-4-yl] 1-O-methyl hexanedioate |
| SMILES | COC(=O)CCC(=O)OC1CC(C)(C)N(OCC(C)(C)O)C(C)(C)C1.COC(=O)CCCCC(=O)OC1CC(C)(C)N(OCC(C)(C)O)C(C)(C)C1 |
| InChI | InChI=1S/C20H37NO6.C18H33NO6/c1-18(2)12-15(27-17(23)11-9-8-10-16(22)25-7)13-19(3,4)21(18)26-14-20(5,6)24;1-16(2)10-13(25-15(21)9-8-14(20)23-7)11-17(3,4)19(16)24-12-18(5,6)22/h15,24H,8-14H2,1-7H3;13,22H,8-12H2,1-7H3 |
| InChIKey | HKWXRKPLXYOTCR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 170.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.98 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|