C36H68N2O4 — CID 172808816
bis(1-tert-butyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 172808816) has the molecular formula C36H68N2O4 and a molecular weight of 592.95 g/mol. Its IUPAC name is bis(1-tert-butyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(1-tert-butyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 172808816 |
| Molecular Formula | C36H68N2O4 |
| Molecular Weight | 592.95 g/mol |
| Exact Mass | 592.52 |
| IUPAC Name | bis(1-tert-butyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CC(C)(C)N1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(C(C)(C)C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C36H68N2O4/c1-31(2,3)37-33(7,8)23-27(24-34(37,9)10)41-29(39)21-19-17-15-16-18-20-22-30(40)42-28-25-35(11,12)38(32(4,5)6)36(13,14)26-28/h27-28H,15-26H2,1-14H3 |
| InChIKey | RWQAAOVMDZWLGP-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.95 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|