C11H23NV — CID 159209902
1,2,2,4,6,6-hexamethylpiperidine;vanadium (PubChem CID 159209902) has the molecular formula C11H23NV and a molecular weight of 220.26 g/mol. Its IUPAC name is 1,2,2,4,6,6-hexamethylpiperidine;vanadium.
| Compound Name | 1,2,2,4,6,6-hexamethylpiperidine;vanadium |
|---|---|
| PubChem CID | 159209902 |
| Molecular Formula | C11H23NV |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 1,2,2,4,6,6-hexamethylpiperidine;vanadium |
| SMILES | CC1CC(C)(C)N(C)C(C)(C)C1.[V] |
| InChI | InChI=1S/C11H23N.V/c1-9-7-10(2,3)12(6)11(4,5)8-9;/h9H,7-8H2,1-6H3; |
| InChIKey | KQJCERJMWCFLCM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |