C24H48N2O2 — CID 18728798
2,2,4,6,6-pentamethyl-1-[2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]piperidine (PubChem CID 18728798) has the molecular formula C24H48N2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is 2,2,4,6,6-pentamethyl-1-[2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]piperidine.
| Compound Name | 2,2,4,6,6-pentamethyl-1-[2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]piperidine |
|---|---|
| PubChem CID | 18728798 |
| Molecular Formula | C24H48N2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | 2,2,4,6,6-pentamethyl-1-[2-methyl-3-(2,2,4,6,6-pentamethylpiperidin-1-yl)oxypropoxy]piperidine |
| SMILES | CC(CON1C(C)(C)CC(C)CC1(C)C)CON1C(C)(C)CC(C)CC1(C)C |
| InChI | InChI=1S/C24H48N2O2/c1-18-12-21(4,5)25(22(6,7)13-18)27-16-20(3)17-28-26-23(8,9)14-19(2)15-24(26,10)11/h18-20H,12-17H2,1-11H3 |
| InChIKey | SVVDAEMUNOWXMB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |