C20H40N2O3 — CID 21182100
4-methoxy-1-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidine (PubChem CID 21182100) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is 4-methoxy-1-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidine.
| Compound Name | 4-methoxy-1-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 21182100 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | 4-methoxy-1-(4-methoxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidine |
| SMILES | COC1CC(C)(C)N(ON2C(C)(C)CC(OC)CC2(C)C)C(C)(C)C1 |
| InChI | InChI=1S/C20H40N2O3/c1-17(2)11-15(23-9)12-18(3,4)21(17)25-22-19(5,6)13-16(24-10)14-20(22,7)8/h15-16H,11-14H2,1-10H3 |
| InChIKey | MFWUAZKQVXWNLD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |