C19H38N2O2 — CID 23514637
1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine (PubChem CID 23514637) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine.
| Compound Name | 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 23514637 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 1-hydroxy-4-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)methyl]-2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CC(CC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C19H38N2O2/c1-16(2)10-14(11-17(3,4)20(16)22)9-15-12-18(5,6)21(23)19(7,8)13-15/h14-15,22-23H,9-13H2,1-8H3 |
| InChIKey | GBIZFKWKMVXVIP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |