C17H37N2O2+ — CID 18760976
ditert-butyl-hydroxy-(2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium (PubChem CID 18760976) has the molecular formula C17H37N2O2+ and a molecular weight of 301.50 g/mol. Its IUPAC name is ditert-butyl-hydroxy-(2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium.
| Compound Name | ditert-butyl-hydroxy-(2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium |
|---|---|
| PubChem CID | 18760976 |
| Molecular Formula | C17H37N2O2+ |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | ditert-butyl-hydroxy-(2,2,6,6-tetramethylpiperidin-1-yl)oxyazanium |
| SMILES | CC1(C)CCCC(C)(C)N1O[N+](O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H37N2O2/c1-14(2,3)19(20,15(4,5)6)21-18-16(7,8)12-11-13-17(18,9)10/h20H,11-13H2,1-10H3/q+1 |
| InChIKey | BVPMEFQJOTYDGA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|