About 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol
4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol (PubChem CID 87894390) has the molecular formula C13H25O7P
and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol.
Molecular Properties
| Compound Name | 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol |
| PubChem CID | 87894390 |
| Molecular Formula | C13H25O7P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol |
| SMILES | CP(=O)(OC1CCC(O)(O)CC1)OC1CCC(O)(O)CC1 |
| InChI | InChI=1S/C13H25O7P/c1-21(18,19-10-2-6-12(14,15)7-3-10)20-11-4-8-13(16,17)9-5-11/h10-11,14-17H,2-9H2,1H3 |
| InChIKey | PADVIXGVYAQDFM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol?
The IUPAC name of 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol (CID 87894390) is 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol.
What is the SMILES notation for 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol?
The canonical SMILES for 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol is CP(=O)(OC1CCC(O)(O)CC1)OC1CCC(O)(O)CC1.
What is the InChIKey of 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol?
The InChIKey is PADVIXGVYAQDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25O7P/c1-21(18,19-10-2-6-12(14,15)7-3-10)20-11-4-8-13(16,17)9-5-11/h10-11,14-17H,2-9H2,1H3.
What are the key properties of 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol?
4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol has a molecular weight of 324.31 g/mol, XLogP of 1.09, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol is sourced from PubChem (CID 87894390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).