C13H25O7P — CID 87894390
4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol (PubChem CID 87894390) has the molecular formula C13H25O7P and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol.
| Compound Name | 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol |
|---|---|
| PubChem CID | 87894390 |
| Molecular Formula | C13H25O7P |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-[(4,4-dihydroxycyclohexyl)oxy-methylphosphoryl]oxycyclohexane-1,1-diol |
| SMILES | CP(=O)(OC1CCC(O)(O)CC1)OC1CCC(O)(O)CC1 |
| InChI | InChI=1S/C13H25O7P/c1-21(18,19-10-2-6-12(14,15)7-3-10)20-11-4-8-13(16,17)9-5-11/h10-11,14-17H,2-9H2,1H3 |
| InChIKey | PADVIXGVYAQDFM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|