C13H28NO5P — CID 173185881
cyclohexanamine;(4,4-dihydroxycyclohexyl)oxy-methylphosphinic acid (PubChem CID 173185881) has the molecular formula C13H28NO5P and a molecular weight of 309.34 g/mol. Its IUPAC name is cyclohexanamine;(4,4-dihydroxycyclohexyl)oxy-methylphosphinic acid.
| Compound Name | cyclohexanamine;(4,4-dihydroxycyclohexyl)oxy-methylphosphinic acid |
|---|---|
| PubChem CID | 173185881 |
| Molecular Formula | C13H28NO5P |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | cyclohexanamine;(4,4-dihydroxycyclohexyl)oxy-methylphosphinic acid |
| SMILES | CP(=O)(O)OC1CCC(O)(O)CC1.NC1CCCCC1 |
| InChI | InChI=1S/C7H15O5P.C6H13N/c1-13(10,11)12-6-2-4-7(8,9)5-3-6;7-6-4-2-1-3-5-6/h6,8-9H,2-5H2,1H3,(H,10,11);6H,1-5,7H2 |
| InChIKey | USKKVXXMUFLBRK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|