C8H16NNa2O4P — CID 158223204
CID 158223204 (PubChem CID 158223204) has the molecular formula C8H16NNa2O4P and a molecular weight of 267.17 g/mol.
| Compound Name | CID 158223204 |
|---|---|
| PubChem CID | 158223204 |
| Molecular Formula | C8H16NNa2O4P |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | — |
| SMILES | CC(=O)NP(=O)(O)OC1CCCCC1.[Na].[Na] |
| InChI | InChI=1S/C8H16NO4P.2Na/c1-7(10)9-14(11,12)13-8-5-3-2-4-6-8;;/h8H,2-6H2,1H3,(H2,9,10,11,12);; |
| InChIKey | GDMMBDCGNCWHMF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|