C9H14F5O3P — CID 87127848
[methyl(1,1,2,2,2-pentafluoroethoxy)phosphoryl]oxycyclohexane (PubChem CID 87127848) has the molecular formula C9H14F5O3P and a molecular weight of 296.17 g/mol. Its IUPAC name is [methyl(1,1,2,2,2-pentafluoroethoxy)phosphoryl]oxycyclohexane.
| Compound Name | [methyl(1,1,2,2,2-pentafluoroethoxy)phosphoryl]oxycyclohexane |
|---|---|
| PubChem CID | 87127848 |
| Molecular Formula | C9H14F5O3P |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [methyl(1,1,2,2,2-pentafluoroethoxy)phosphoryl]oxycyclohexane |
| SMILES | CP(=O)(OC1CCCCC1)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H14F5O3P/c1-18(15,16-7-5-3-2-4-6-7)17-9(13,14)8(10,11)12/h7H,2-6H2,1H3 |
| InChIKey | YAAJJNRYQOPYTL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|