C10H11F9O3P- — CID 154075463
cyclohexyloxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphinate (PubChem CID 154075463) has the molecular formula C10H11F9O3P- and a molecular weight of 381.15 g/mol. Its IUPAC name is cyclohexyloxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphinate.
| Compound Name | cyclohexyloxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphinate |
|---|---|
| PubChem CID | 154075463 |
| Molecular Formula | C10H11F9O3P- |
| Molecular Weight | 381.15 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | cyclohexyloxy(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phosphinate |
| SMILES | O=P([O-])(OC1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F9O3P/c11-7(12,9(15,16)17)8(13,14)10(18,19)23(20,21)22-6-4-2-1-3-5-6/h6H,1-5H2,(H,20,21)/p-1 |
| InChIKey | YLXSZRRICCPVBG-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.15 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|